C11H12N2O3S2 — CID 47096897
2-(2-methylsulfonylethylsulfanyl)-5-phenyl-1,3,4-oxadiazole (PubChem CID 47096897) has the molecular formula C11H12N2O3S2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-(2-methylsulfonylethylsulfanyl)-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-(2-methylsulfonylethylsulfanyl)-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 47096897 |
| Molecular Formula | C11H12N2O3S2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 2-(2-methylsulfonylethylsulfanyl)-5-phenyl-1,3,4-oxadiazole |
| SMILES | CS(=O)(=O)CCSc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C11H12N2O3S2/c1-18(14,15)8-7-17-11-13-12-10(16-11)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 |
| InChIKey | WAXPTQAGUNYLEJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |