C17H11N3O3S — CID 7459288
2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]isoindole-1,3-dione (PubChem CID 7459288) has the molecular formula C17H11N3O3S and a molecular weight of 337.36 g/mol. Its IUPAC name is 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]isoindole-1,3-dione.
| Compound Name | 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 7459288 |
| Molecular Formula | C17H11N3O3S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CSc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C17H11N3O3S/c21-15-12-8-4-5-9-13(12)16(22)20(15)10-24-17-19-18-14(23-17)11-6-2-1-3-7-11/h1-9H,10H2 |
| InChIKey | WOWCVZLAPWFRGN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|