C18H12BrN3O3S — CID 5243208
2-[2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethyl]isoindole-1,3-dione (PubChem CID 5243208) has the molecular formula C18H12BrN3O3S and a molecular weight of 430.28 g/mol. Its IUPAC name is 2-[2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 5243208 |
| Molecular Formula | C18H12BrN3O3S |
| Molecular Weight | 430.28 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | 2-[2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCSc1nnc(-c2ccccc2Br)o1 |
| InChI | InChI=1S/C18H12BrN3O3S/c19-14-8-4-3-7-13(14)15-20-21-18(25-15)26-10-9-22-16(23)11-5-1-2-6-12(11)17(22)24/h1-8H,9-10H2 |
| InChIKey | CQRNNPIOOVEPPU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|