C14H9F3N4O2S — CID 19811954
2-phenyl-5-[5-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3,4-oxadiazol-2-yl]-1,3,4-oxadiazole (PubChem CID 19811954) has the molecular formula C14H9F3N4O2S and a molecular weight of 354.31 g/mol. Its IUPAC name is 2-phenyl-5-[5-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3,4-oxadiazol-2-yl]-1,3,4-oxadiazole.
| Compound Name | 2-phenyl-5-[5-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3,4-oxadiazol-2-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 19811954 |
| Molecular Formula | C14H9F3N4O2S |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 2-phenyl-5-[5-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3,4-oxadiazol-2-yl]-1,3,4-oxadiazole |
| SMILES | FC(F)=C(F)CCSc1nnc(-c2nnc(-c3ccccc3)o2)o1 |
| InChI | InChI=1S/C14H9F3N4O2S/c15-9(10(16)17)6-7-24-14-21-20-13(23-14)12-19-18-11(22-12)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | ASRCAZGFZUTRFC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |