C17H14N2O4S — CID 23010008
2-[2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]benzoic acid (PubChem CID 23010008) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is 2-[2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]benzoic acid.
| Compound Name | 2-[2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 23010008 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 2-[2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]benzoic acid |
| SMILES | O=C(O)c1ccccc1OCCSc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C17H14N2O4S/c20-16(21)13-8-4-5-9-14(13)22-10-11-24-17-19-18-15(23-17)12-6-2-1-3-7-12/h1-9H,10-11H2,(H,20,21) |
| InChIKey | PHMLBOHSBKIGPG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|