C18H18N2O2S — CID 60545180
2-(3,5-dimethylphenyl)-5-(2-phenoxyethylsulfanyl)-1,3,4-oxadiazole (PubChem CID 60545180) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-5-(2-phenoxyethylsulfanyl)-1,3,4-oxadiazole.
| Compound Name | 2-(3,5-dimethylphenyl)-5-(2-phenoxyethylsulfanyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 60545180 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-5-(2-phenoxyethylsulfanyl)-1,3,4-oxadiazole |
| SMILES | Cc1cc(C)cc(-c2nnc(SCCOc3ccccc3)o2)c1 |
| InChI | InChI=1S/C18H18N2O2S/c1-13-10-14(2)12-15(11-13)17-19-20-18(22-17)23-9-8-21-16-6-4-3-5-7-16/h3-7,10-12H,8-9H2,1-2H3 |
| InChIKey | OKNMIQCWCKVZIA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|