C21H24N2O4S — CID 8602749
2-(3,5-dimethoxyphenyl)-5-[3-(3,5-dimethylphenoxy)propylsulfanyl]-1,3,4-oxadiazole (PubChem CID 8602749) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-5-[3-(3,5-dimethylphenoxy)propylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(3,5-dimethoxyphenyl)-5-[3-(3,5-dimethylphenoxy)propylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 8602749 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-5-[3-(3,5-dimethylphenoxy)propylsulfanyl]-1,3,4-oxadiazole |
| SMILES | COc1cc(OC)cc(-c2nnc(SCCCOc3cc(C)cc(C)c3)o2)c1 |
| InChI | InChI=1S/C21H24N2O4S/c1-14-8-15(2)10-19(9-14)26-6-5-7-28-21-23-22-20(27-21)16-11-17(24-3)13-18(12-16)25-4/h8-13H,5-7H2,1-4H3 |
| InChIKey | SSGOSDKOUXBLFK-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|