C14H18N2O5S — CID 86806278
2-(2,2-dimethoxyethylsulfanyl)-5-(3,5-dimethoxyphenyl)-1,3,4-oxadiazole (PubChem CID 86806278) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethylsulfanyl)-5-(3,5-dimethoxyphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(2,2-dimethoxyethylsulfanyl)-5-(3,5-dimethoxyphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 86806278 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-(2,2-dimethoxyethylsulfanyl)-5-(3,5-dimethoxyphenyl)-1,3,4-oxadiazole |
| SMILES | COc1cc(OC)cc(-c2nnc(SCC(OC)OC)o2)c1 |
| InChI | InChI=1S/C14H18N2O5S/c1-17-10-5-9(6-11(7-10)18-2)13-15-16-14(21-13)22-8-12(19-3)20-4/h5-7,12H,8H2,1-4H3 |
| InChIKey | ZROXWDWSGGKNEA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 75.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|