C7H12N2O3S — CID 66221730
2-(2,2-dimethoxyethylsulfanyl)-5-methyl-1,3,4-oxadiazole (PubChem CID 66221730) has the molecular formula C7H12N2O3S and a molecular weight of 204.25 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethylsulfanyl)-5-methyl-1,3,4-oxadiazole.
| Compound Name | 2-(2,2-dimethoxyethylsulfanyl)-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 66221730 |
| Molecular Formula | C7H12N2O3S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 2-(2,2-dimethoxyethylsulfanyl)-5-methyl-1,3,4-oxadiazole |
| SMILES | COC(CSc1nnc(C)o1)OC |
| InChI | InChI=1S/C7H12N2O3S/c1-5-8-9-7(12-5)13-4-6(10-2)11-3/h6H,4H2,1-3H3 |
| InChIKey | NBEJJAJSRJGXER-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|