C6H6BrF3N2OS — CID 64757134
2-(2-bromo-3,3,3-trifluoropropyl)sulfanyl-5-methyl-1,3,4-oxadiazole (PubChem CID 64757134) has the molecular formula C6H6BrF3N2OS and a molecular weight of 291.09 g/mol. Its IUPAC name is 2-(2-bromo-3,3,3-trifluoropropyl)sulfanyl-5-methyl-1,3,4-oxadiazole.
| Compound Name | 2-(2-bromo-3,3,3-trifluoropropyl)sulfanyl-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 64757134 |
| Molecular Formula | C6H6BrF3N2OS |
| Molecular Weight | 291.09 g/mol |
| Exact Mass | 289.93 |
| IUPAC Name | 2-(2-bromo-3,3,3-trifluoropropyl)sulfanyl-5-methyl-1,3,4-oxadiazole |
| SMILES | Cc1nnc(SCC(Br)C(F)(F)F)o1 |
| InChI | InChI=1S/C6H6BrF3N2OS/c1-3-11-12-5(13-3)14-2-4(7)6(8,9)10/h4H,2H2,1H3 |
| InChIKey | QOORRSXJJDXVCR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.09 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|