About (2S)-1-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propan-2-amine
(2S)-1-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propan-2-amine (PubChem CID 104889207) has the molecular formula C6H11N3OS
and a molecular weight of 173.24 g/mol. Its IUPAC name is (2S)-1-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propan-2-amine.
Molecular Properties
| Compound Name | (2S)-1-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propan-2-amine |
| PubChem CID | 104889207 |
| Molecular Formula | C6H11N3OS |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | (2S)-1-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propan-2-amine |
| SMILES | Cc1nnc(SC[C@H](C)N)o1 |
| InChI | InChI=1S/C6H11N3OS/c1-4(7)3-11-6-9-8-5(2)10-6/h4H,3,7H2,1-2H3/t4-/m0/s1 |
| InChIKey | RFCQRWWAROWFDW-BYPYZUCNSA-N |
| XLogP | 0.82 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-1-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propan-2-amine?
The IUPAC name of (2S)-1-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propan-2-amine (CID 104889207) is (2S)-1-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propan-2-amine.
What is the SMILES notation for (2S)-1-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propan-2-amine?
The canonical SMILES for (2S)-1-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propan-2-amine is Cc1nnc(SC[C@H](C)N)o1.
What is the InChIKey of (2S)-1-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propan-2-amine?
The InChIKey is RFCQRWWAROWFDW-BYPYZUCNSA-N. The full InChI is InChI=1S/C6H11N3OS/c1-4(7)3-11-6-9-8-5(2)10-6/h4H,3,7H2,1-2H3/t4-/m0/s1.
What are the key properties of (2S)-1-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propan-2-amine?
(2S)-1-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propan-2-amine has a molecular weight of 173.24 g/mol, XLogP of 0.82, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propan-2-amine is sourced from PubChem (CID 104889207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).