C9H16N2O2S — CID 103867892
6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]hexan-1-ol (PubChem CID 103867892) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]hexan-1-ol.
| Compound Name | 6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]hexan-1-ol |
|---|---|
| PubChem CID | 103867892 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]hexan-1-ol |
| SMILES | Cc1nnc(SCCCCCCO)o1 |
| InChI | InChI=1S/C9H16N2O2S/c1-8-10-11-9(13-8)14-7-5-3-2-4-6-12/h12H,2-7H2,1H3 |
| InChIKey | OCYYWXUVUJGCFQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|