About 2-methyl-5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)pentanamide
2-methyl-5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)pentanamide (PubChem CID 62253671) has the molecular formula C12H22N4O2S
and a molecular weight of 286.40 g/mol. Its IUPAC name is 2-methyl-5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)pentanamide.
Molecular Properties
| Compound Name | 2-methyl-5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)pentanamide |
| PubChem CID | 62253671 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2-methyl-5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)pentanamide |
| SMILES | CCCNC(C)(CCCSc1nnc(C)o1)C(N)=O |
| InChI | InChI=1S/C12H22N4O2S/c1-4-7-14-12(3,10(13)17)6-5-8-19-11-16-15-9(2)18-11/h14H,4-8H2,1-3H3,(H2,13,17) |
| InChIKey | DIWIDLGZJRRLSA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)pentanamide?
The IUPAC name of 2-methyl-5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)pentanamide (CID 62253671) is 2-methyl-5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)pentanamide.
What is the SMILES notation for 2-methyl-5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)pentanamide?
The canonical SMILES for 2-methyl-5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)pentanamide is CCCNC(C)(CCCSc1nnc(C)o1)C(N)=O.
What is the InChIKey of 2-methyl-5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)pentanamide?
The InChIKey is DIWIDLGZJRRLSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O2S/c1-4-7-14-12(3,10(13)17)6-5-8-19-11-16-15-9(2)18-11/h14H,4-8H2,1-3H3,(H2,13,17).
What are the key properties of 2-methyl-5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)pentanamide?
2-methyl-5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)pentanamide has a molecular weight of 286.40 g/mol, XLogP of 1.49, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)pentanamide is sourced from PubChem (CID 62253671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).