C13H23N3O3S — CID 62254728
ethyl 2-methyl-2-(methylamino)-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]hexanoate (PubChem CID 62254728) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is ethyl 2-methyl-2-(methylamino)-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]hexanoate.
| Compound Name | ethyl 2-methyl-2-(methylamino)-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]hexanoate |
|---|---|
| PubChem CID | 62254728 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | ethyl 2-methyl-2-(methylamino)-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]hexanoate |
| SMILES | CCOC(=O)C(C)(CCCCSc1nnc(C)o1)NC |
| InChI | InChI=1S/C13H23N3O3S/c1-5-18-11(17)13(3,14-4)8-6-7-9-20-12-16-15-10(2)19-12/h14H,5-9H2,1-4H3 |
| InChIKey | SEPLSLNMIAJFBC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|