C13H23N3O2S3 — CID 115383476
ethyl 2-methyl-2-(methylamino)-6-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexanoate (PubChem CID 115383476) has the molecular formula C13H23N3O2S3 and a molecular weight of 349.55 g/mol. Its IUPAC name is ethyl 2-methyl-2-(methylamino)-6-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexanoate.
| Compound Name | ethyl 2-methyl-2-(methylamino)-6-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexanoate |
|---|---|
| PubChem CID | 115383476 |
| Molecular Formula | C13H23N3O2S3 |
| Molecular Weight | 349.55 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | ethyl 2-methyl-2-(methylamino)-6-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]hexanoate |
| SMILES | CCOC(=O)C(C)(CCCCSc1nnc(SC)s1)NC |
| InChI | InChI=1S/C13H23N3O2S3/c1-5-18-10(17)13(2,14-3)8-6-7-9-20-12-16-15-11(19-4)21-12/h14H,5-9H2,1-4H3 |
| InChIKey | BEULFHICOKAIDL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.55 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|