C11H21N3S3 — CID 115383711
N-tert-butyl-4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]butan-1-amine (PubChem CID 115383711) has the molecular formula C11H21N3S3 and a molecular weight of 291.51 g/mol. Its IUPAC name is N-tert-butyl-4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]butan-1-amine.
| Compound Name | N-tert-butyl-4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]butan-1-amine |
|---|---|
| PubChem CID | 115383711 |
| Molecular Formula | C11H21N3S3 |
| Molecular Weight | 291.51 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-tert-butyl-4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]butan-1-amine |
| SMILES | CSc1nnc(SCCCCNC(C)(C)C)s1 |
| InChI | InChI=1S/C11H21N3S3/c1-11(2,3)12-7-5-6-8-16-10-14-13-9(15-4)17-10/h12H,5-8H2,1-4H3 |
| InChIKey | MOZJUIQQOKCOBJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|