C10H19N3S3 — CID 115384098
N-ethyl-5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pentan-2-amine (PubChem CID 115384098) has the molecular formula C10H19N3S3 and a molecular weight of 277.48 g/mol. Its IUPAC name is N-ethyl-5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pentan-2-amine.
| Compound Name | N-ethyl-5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pentan-2-amine |
|---|---|
| PubChem CID | 115384098 |
| Molecular Formula | C10H19N3S3 |
| Molecular Weight | 277.48 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-ethyl-5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pentan-2-amine |
| SMILES | CCNC(C)CCCSc1nnc(SC)s1 |
| InChI | InChI=1S/C10H19N3S3/c1-4-11-8(2)6-5-7-15-10-13-12-9(14-3)16-10/h8,11H,4-7H2,1-3H3 |
| InChIKey | PWFNHYUHLMYTKE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|