C9H16N2S4 — CID 115384298
3-methyl-5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pentane-1-thiol (PubChem CID 115384298) has the molecular formula C9H16N2S4 and a molecular weight of 280.51 g/mol. Its IUPAC name is 3-methyl-5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pentane-1-thiol.
| Compound Name | 3-methyl-5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pentane-1-thiol |
|---|---|
| PubChem CID | 115384298 |
| Molecular Formula | C9H16N2S4 |
| Molecular Weight | 280.51 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 3-methyl-5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pentane-1-thiol |
| SMILES | CSc1nnc(SCCC(C)CCS)s1 |
| InChI | InChI=1S/C9H16N2S4/c1-7(3-5-12)4-6-14-9-11-10-8(13-2)15-9/h7,12H,3-6H2,1-2H3 |
| InChIKey | ZEPSEZOISPHGPS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 25.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|