C7H8N2S3 — CID 131019948
2-but-2-ynylsulfanyl-5-methylsulfanyl-1,3,4-thiadiazole (PubChem CID 131019948) has the molecular formula C7H8N2S3 and a molecular weight of 216.36 g/mol. Its IUPAC name is 2-but-2-ynylsulfanyl-5-methylsulfanyl-1,3,4-thiadiazole.
| Compound Name | 2-but-2-ynylsulfanyl-5-methylsulfanyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 131019948 |
| Molecular Formula | C7H8N2S3 |
| Molecular Weight | 216.36 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | 2-but-2-ynylsulfanyl-5-methylsulfanyl-1,3,4-thiadiazole |
| SMILES | CC#CCSc1nnc(SC)s1 |
| InChI | InChI=1S/C7H8N2S3/c1-3-4-5-11-7-9-8-6(10-2)12-7/h5H2,1-2H3 |
| InChIKey | BMUXTKFGFBTWLJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|