C6H9BrN2S3 — CID 115382657
2-(3-bromopropylsulfanyl)-5-methylsulfanyl-1,3,4-thiadiazole (PubChem CID 115382657) has the molecular formula C6H9BrN2S3 and a molecular weight of 285.26 g/mol. Its IUPAC name is 2-(3-bromopropylsulfanyl)-5-methylsulfanyl-1,3,4-thiadiazole.
| Compound Name | 2-(3-bromopropylsulfanyl)-5-methylsulfanyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 115382657 |
| Molecular Formula | C6H9BrN2S3 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 283.91 |
| IUPAC Name | 2-(3-bromopropylsulfanyl)-5-methylsulfanyl-1,3,4-thiadiazole |
| SMILES | CSc1nnc(SCCCBr)s1 |
| InChI | InChI=1S/C6H9BrN2S3/c1-10-5-8-9-6(12-5)11-4-2-3-7/h2-4H2,1H3 |
| InChIKey | RSYKFDIDAALQGL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|