C9H17N3OS3 — CID 115383736
3-methoxy-N-[2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]propan-1-amine (PubChem CID 115383736) has the molecular formula C9H17N3OS3 and a molecular weight of 279.46 g/mol. Its IUPAC name is 3-methoxy-N-[2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]propan-1-amine.
| Compound Name | 3-methoxy-N-[2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 115383736 |
| Molecular Formula | C9H17N3OS3 |
| Molecular Weight | 279.46 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 3-methoxy-N-[2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]propan-1-amine |
| SMILES | COCCCNCCSc1nnc(SC)s1 |
| InChI | InChI=1S/C9H17N3OS3/c1-13-6-3-4-10-5-7-15-9-12-11-8(14-2)16-9/h10H,3-7H2,1-2H3 |
| InChIKey | VWIAJKPIOMQSFT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|