C7H13N3OS2 — CID 115626683
5-(4-methoxybutylsulfanyl)-1,3,4-thiadiazol-2-amine (PubChem CID 115626683) has the molecular formula C7H13N3OS2 and a molecular weight of 219.33 g/mol. Its IUPAC name is 5-(4-methoxybutylsulfanyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(4-methoxybutylsulfanyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 115626683 |
| Molecular Formula | C7H13N3OS2 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 5-(4-methoxybutylsulfanyl)-1,3,4-thiadiazol-2-amine |
| SMILES | COCCCCSc1nnc(N)s1 |
| InChI | InChI=1S/C7H13N3OS2/c1-11-4-2-3-5-12-7-10-9-6(8)13-7/h2-5H2,1H3,(H2,8,9) |
| InChIKey | XDCMABWSMXUDDS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|