C6H11N3O2S2 — CID 81093628
5-(2,2-dimethoxyethylsulfanyl)-1,3,4-thiadiazol-2-amine (PubChem CID 81093628) has the molecular formula C6H11N3O2S2 and a molecular weight of 221.31 g/mol. Its IUPAC name is 5-(2,2-dimethoxyethylsulfanyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(2,2-dimethoxyethylsulfanyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 81093628 |
| Molecular Formula | C6H11N3O2S2 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 5-(2,2-dimethoxyethylsulfanyl)-1,3,4-thiadiazol-2-amine |
| SMILES | COC(CSc1nnc(N)s1)OC |
| InChI | InChI=1S/C6H11N3O2S2/c1-10-4(11-2)3-12-6-9-8-5(7)13-6/h4H,3H2,1-2H3,(H2,7,8) |
| InChIKey | JQTOUAXDPVRYED-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|