C6H11N3S3 — CID 115647521
5-(3-methylsulfanylpropylsulfanyl)-1,3,4-thiadiazol-2-amine (PubChem CID 115647521) has the molecular formula C6H11N3S3 and a molecular weight of 221.38 g/mol. Its IUPAC name is 5-(3-methylsulfanylpropylsulfanyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(3-methylsulfanylpropylsulfanyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 115647521 |
| Molecular Formula | C6H11N3S3 |
| Molecular Weight | 221.38 g/mol |
| Exact Mass | 221.01 |
| IUPAC Name | 5-(3-methylsulfanylpropylsulfanyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CSCCCSc1nnc(N)s1 |
| InChI | InChI=1S/C6H11N3S3/c1-10-3-2-4-11-6-9-8-5(7)12-6/h2-4H2,1H3,(H2,7,8) |
| InChIKey | QMLZOGWYYYAXGW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|