C11H13N3S2 — CID 6494481
5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-amine (PubChem CID 6494481) has the molecular formula C11H13N3S2 and a molecular weight of 251.38 g/mol. Its IUPAC name is 5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 6494481 |
| Molecular Formula | C11H13N3S2 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(SCCCc2ccccc2)s1 |
| InChI | InChI=1S/C11H13N3S2/c12-10-13-14-11(16-10)15-8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H2,12,13) |
| InChIKey | IGXCUMJMYIDAMV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|