C6H10N4OS2 — CID 24659819
N-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]acetamide (PubChem CID 24659819) has the molecular formula C6H10N4OS2 and a molecular weight of 218.31 g/mol. Its IUPAC name is N-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]acetamide.
| Compound Name | N-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 24659819 |
| Molecular Formula | C6H10N4OS2 |
| Molecular Weight | 218.31 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | N-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]acetamide |
| SMILES | CC(=O)NCCSc1nnc(N)s1 |
| InChI | InChI=1S/C6H10N4OS2/c1-4(11)8-2-3-12-6-10-9-5(7)13-6/h2-3H2,1H3,(H2,7,9)(H,8,11) |
| InChIKey | NKIRADOGFORFOU-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.31 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|