C7H9F3N4OS2 — CID 71917031
N-[3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-2,2,2-trifluoroacetamide (PubChem CID 71917031) has the molecular formula C7H9F3N4OS2 and a molecular weight of 286.30 g/mol. Its IUPAC name is N-[3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 71917031 |
| Molecular Formula | C7H9F3N4OS2 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | N-[3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-2,2,2-trifluoroacetamide |
| SMILES | Nc1nnc(SCCCNC(=O)C(F)(F)F)s1 |
| InChI | InChI=1S/C7H9F3N4OS2/c8-7(9,10)4(15)12-2-1-3-16-6-14-13-5(11)17-6/h1-3H2,(H2,11,13)(H,12,15) |
| InChIKey | OYFUICQNCDAMPL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|