C8H14N4OS2 — CID 9379614
N-[2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]acetamide (PubChem CID 9379614) has the molecular formula C8H14N4OS2 and a molecular weight of 246.36 g/mol. Its IUPAC name is N-[2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]acetamide.
| Compound Name | N-[2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 9379614 |
| Molecular Formula | C8H14N4OS2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | N-[2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]acetamide |
| SMILES | CCNc1nnc(SCCNC(C)=O)s1 |
| InChI | InChI=1S/C8H14N4OS2/c1-3-9-7-11-12-8(15-7)14-5-4-10-6(2)13/h3-5H2,1-2H3,(H,9,11)(H,10,13) |
| InChIKey | DUGWHEODTBOKOE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|