C7H10N4S2 — CID 9379522
3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanenitrile (PubChem CID 9379522) has the molecular formula C7H10N4S2 and a molecular weight of 214.32 g/mol. Its IUPAC name is 3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanenitrile.
| Compound Name | 3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanenitrile |
|---|---|
| PubChem CID | 9379522 |
| Molecular Formula | C7H10N4S2 |
| Molecular Weight | 214.32 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanenitrile |
| SMILES | CCNc1nnc(SCCC#N)s1 |
| InChI | InChI=1S/C7H10N4S2/c1-2-9-6-10-11-7(13-6)12-5-3-4-8/h2-3,5H2,1H3,(H,9,10) |
| InChIKey | OOHRAIZCLZUWSQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|