C13H14N4S2 — CID 7449027
4-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanenitrile (PubChem CID 7449027) has the molecular formula C13H14N4S2 and a molecular weight of 290.42 g/mol. Its IUPAC name is 4-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanenitrile.
| Compound Name | 4-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanenitrile |
|---|---|
| PubChem CID | 7449027 |
| Molecular Formula | C13H14N4S2 |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 4-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanenitrile |
| SMILES | N#CCCCSc1nnc(NCc2ccccc2)s1 |
| InChI | InChI=1S/C13H14N4S2/c14-8-4-5-9-18-13-17-16-12(19-13)15-10-11-6-2-1-3-7-11/h1-3,6-7H,4-5,9-10H2,(H,15,16) |
| InChIKey | VNOIVTRMXMQFQZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|