C15H18N4S2 — CID 112779434
5-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]pentanenitrile (PubChem CID 112779434) has the molecular formula C15H18N4S2 and a molecular weight of 318.47 g/mol. Its IUPAC name is 5-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]pentanenitrile.
| Compound Name | 5-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]pentanenitrile |
|---|---|
| PubChem CID | 112779434 |
| Molecular Formula | C15H18N4S2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 5-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]pentanenitrile |
| SMILES | Cc1cccc(Nc2nnc(SCCCCC#N)s2)c1C |
| InChI | InChI=1S/C15H18N4S2/c1-11-7-6-8-13(12(11)2)17-14-18-19-15(21-14)20-10-5-3-4-9-16/h6-8H,3-5,10H2,1-2H3,(H,17,18) |
| InChIKey | OMFSWEJJZKARIK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|