C13H14N4OS2 — CID 7863581
4-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanenitrile (PubChem CID 7863581) has the molecular formula C13H14N4OS2 and a molecular weight of 306.42 g/mol. Its IUPAC name is 4-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanenitrile.
| Compound Name | 4-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanenitrile |
|---|---|
| PubChem CID | 7863581 |
| Molecular Formula | C13H14N4OS2 |
| Molecular Weight | 306.42 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 4-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanenitrile |
| SMILES | COc1ccc(Nc2nnc(SCCCC#N)s2)cc1 |
| InChI | InChI=1S/C13H14N4OS2/c1-18-11-6-4-10(5-7-11)15-12-16-17-13(20-12)19-9-3-2-8-14/h4-7H,2-3,9H2,1H3,(H,15,16) |
| InChIKey | AXLSFGQOOAGMCI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|