C17H17N3O2S2 — CID 2659144
N-(4-methoxyphenyl)-5-(2-phenoxyethylsulfanyl)-1,3,4-thiadiazol-2-amine (PubChem CID 2659144) has the molecular formula C17H17N3O2S2 and a molecular weight of 359.48 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-5-(2-phenoxyethylsulfanyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(4-methoxyphenyl)-5-(2-phenoxyethylsulfanyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 2659144 |
| Molecular Formula | C17H17N3O2S2 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | N-(4-methoxyphenyl)-5-(2-phenoxyethylsulfanyl)-1,3,4-thiadiazol-2-amine |
| SMILES | COc1ccc(Nc2nnc(SCCOc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C17H17N3O2S2/c1-21-14-9-7-13(8-10-14)18-16-19-20-17(24-16)23-12-11-22-15-5-3-2-4-6-15/h2-10H,11-12H2,1H3,(H,18,19) |
| InChIKey | MQXUKGPRTPLXLG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|