C17H15N3O3S2 — CID 28916143
4-[2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]ethoxy]benzoic acid (PubChem CID 28916143) has the molecular formula C17H15N3O3S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 4-[2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]ethoxy]benzoic acid.
| Compound Name | 4-[2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 28916143 |
| Molecular Formula | C17H15N3O3S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 4-[2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]ethoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCSc2nnc(Nc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C17H15N3O3S2/c21-15(22)12-6-8-14(9-7-12)23-10-11-24-17-20-19-16(25-17)18-13-4-2-1-3-5-13/h1-9H,10-11H2,(H,18,19)(H,21,22) |
| InChIKey | GBTLSAHUKMHKCO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|