C24H23N3O3S2 — CID 3944918
5-[2-(4-ethoxyphenoxy)ethylsulfanyl]-N-(4-phenoxyphenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 3944918) has the molecular formula C24H23N3O3S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is 5-[2-(4-ethoxyphenoxy)ethylsulfanyl]-N-(4-phenoxyphenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[2-(4-ethoxyphenoxy)ethylsulfanyl]-N-(4-phenoxyphenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 3944918 |
| Molecular Formula | C24H23N3O3S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 5-[2-(4-ethoxyphenoxy)ethylsulfanyl]-N-(4-phenoxyphenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CCOc1ccc(OCCSc2nnc(Nc3ccc(Oc4ccccc4)cc3)s2)cc1 |
| InChI | InChI=1S/C24H23N3O3S2/c1-2-28-19-12-14-20(15-13-19)29-16-17-31-24-27-26-23(32-24)25-18-8-10-22(11-9-18)30-21-6-4-3-5-7-21/h3-15H,2,16-17H2,1H3,(H,25,26) |
| InChIKey | KXOYAPFSORPJOV-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|