C18H18BrN3O2S2 — CID 3985934
5-[2-(4-bromophenoxy)ethylsulfanyl]-N-(2-ethoxyphenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 3985934) has the molecular formula C18H18BrN3O2S2 and a molecular weight of 452.40 g/mol. Its IUPAC name is 5-[2-(4-bromophenoxy)ethylsulfanyl]-N-(2-ethoxyphenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[2-(4-bromophenoxy)ethylsulfanyl]-N-(2-ethoxyphenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 3985934 |
| Molecular Formula | C18H18BrN3O2S2 |
| Molecular Weight | 452.40 g/mol |
| Exact Mass | 451.00 |
| IUPAC Name | 5-[2-(4-bromophenoxy)ethylsulfanyl]-N-(2-ethoxyphenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CCOc1ccccc1Nc1nnc(SCCOc2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C18H18BrN3O2S2/c1-2-23-16-6-4-3-5-15(16)20-17-21-22-18(26-17)25-12-11-24-14-9-7-13(19)8-10-14/h3-10H,2,11-12H2,1H3,(H,20,21) |
| InChIKey | FNYPXNBVUDBTGW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.40 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|