C17H13FN4OS2 — CID 42976270
4-[2-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethoxy]benzonitrile (PubChem CID 42976270) has the molecular formula C17H13FN4OS2 and a molecular weight of 372.45 g/mol. Its IUPAC name is 4-[2-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethoxy]benzonitrile.
| Compound Name | 4-[2-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 42976270 |
| Molecular Formula | C17H13FN4OS2 |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 4-[2-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCCSc2nnc(Nc3ccccc3F)s2)cc1 |
| InChI | InChI=1S/C17H13FN4OS2/c18-14-3-1-2-4-15(14)20-16-21-22-17(25-16)24-10-9-23-13-7-5-12(11-19)6-8-13/h1-8H,9-10H2,(H,20,21) |
| InChIKey | PAXDSNWBCRMMLR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|