C18H19N3O2S2 — CID 3321673
5-[2-(4-ethoxyphenoxy)ethylsulfanyl]-N-phenyl-1,3,4-thiadiazol-2-amine (PubChem CID 3321673) has the molecular formula C18H19N3O2S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 5-[2-(4-ethoxyphenoxy)ethylsulfanyl]-N-phenyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[2-(4-ethoxyphenoxy)ethylsulfanyl]-N-phenyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 3321673 |
| Molecular Formula | C18H19N3O2S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 5-[2-(4-ethoxyphenoxy)ethylsulfanyl]-N-phenyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCOc1ccc(OCCSc2nnc(Nc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C18H19N3O2S2/c1-2-22-15-8-10-16(11-9-15)23-12-13-24-18-21-20-17(25-18)19-14-6-4-3-5-7-14/h3-11H,2,12-13H2,1H3,(H,19,20) |
| InChIKey | DVBRBBQDHJYKEX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|