C13H15N3OS2 — CID 7797226
5-(2-phenoxyethylsulfanyl)-N-prop-2-enyl-1,3,4-thiadiazol-2-amine (PubChem CID 7797226) has the molecular formula C13H15N3OS2 and a molecular weight of 293.42 g/mol. Its IUPAC name is 5-(2-phenoxyethylsulfanyl)-N-prop-2-enyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(2-phenoxyethylsulfanyl)-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 7797226 |
| Molecular Formula | C13H15N3OS2 |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 5-(2-phenoxyethylsulfanyl)-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
| SMILES | C=CCNc1nnc(SCCOc2ccccc2)s1 |
| InChI | InChI=1S/C13H15N3OS2/c1-2-8-14-12-15-16-13(19-12)18-10-9-17-11-6-4-3-5-7-11/h2-7H,1,8-10H2,(H,14,15) |
| InChIKey | QLXZLYLMBOJVPT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|