C13H13Cl2N3OS2 — CID 7797996
5-[2-(2,6-dichlorophenoxy)ethylsulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine (PubChem CID 7797996) has the molecular formula C13H13Cl2N3OS2 and a molecular weight of 362.31 g/mol. Its IUPAC name is 5-[2-(2,6-dichlorophenoxy)ethylsulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[2-(2,6-dichlorophenoxy)ethylsulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 7797996 |
| Molecular Formula | C13H13Cl2N3OS2 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 5-[2-(2,6-dichlorophenoxy)ethylsulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
| SMILES | C=CCNc1nnc(SCCOc2c(Cl)cccc2Cl)s1 |
| InChI | InChI=1S/C13H13Cl2N3OS2/c1-2-6-16-12-17-18-13(21-12)20-8-7-19-11-9(14)4-3-5-10(11)15/h2-5H,1,6-8H2,(H,16,17) |
| InChIKey | BOCDJTTUCBAXJJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|