C11H14N4S3 — CID 18165695
5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine (PubChem CID 18165695) has the molecular formula C11H14N4S3 and a molecular weight of 298.46 g/mol. Its IUPAC name is 5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 18165695 |
| Molecular Formula | C11H14N4S3 |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
| SMILES | C=CCNc1nnc(SCc2csc(CC)n2)s1 |
| InChI | InChI=1S/C11H14N4S3/c1-3-5-12-10-14-15-11(18-10)17-7-8-6-16-9(4-2)13-8/h3,6H,1,4-5,7H2,2H3,(H,12,14) |
| InChIKey | LIMCXRSCYAJPRG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|