C6H9N3S2 — CID 83380562
5-methylsulfanyl-N-prop-2-enyl-1,3,4-thiadiazol-2-amine (PubChem CID 83380562) has the molecular formula C6H9N3S2 and a molecular weight of 187.29 g/mol. Its IUPAC name is 5-methylsulfanyl-N-prop-2-enyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-methylsulfanyl-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 83380562 |
| Molecular Formula | C6H9N3S2 |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.02 |
| IUPAC Name | 5-methylsulfanyl-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
| SMILES | C=CCNc1nnc(SC)s1 |
| InChI | InChI=1S/C6H9N3S2/c1-3-4-7-5-8-9-6(10-2)11-5/h3H,1,4H2,2H3,(H,7,8) |
| InChIKey | ODIJVJOEFZCXMJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|