C12H19N3OS2 — CID 47395810
1-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]cyclohexan-1-ol (PubChem CID 47395810) has the molecular formula C12H19N3OS2 and a molecular weight of 285.44 g/mol. Its IUPAC name is 1-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]cyclohexan-1-ol.
| Compound Name | 1-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 47395810 |
| Molecular Formula | C12H19N3OS2 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]cyclohexan-1-ol |
| SMILES | C=CCNc1nnc(SCC2(O)CCCCC2)s1 |
| InChI | InChI=1S/C12H19N3OS2/c1-2-8-13-10-14-15-11(18-10)17-9-12(16)6-4-3-5-7-12/h2,16H,1,3-9H2,(H,13,14) |
| InChIKey | YZTOOSWHWSYXNQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|