C17H24N4OS2 — CID 7798116
N-(1-adamantyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 7798116) has the molecular formula C17H24N4OS2 and a molecular weight of 364.54 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(1-adamantyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 7798116 |
| Molecular Formula | C17H24N4OS2 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N-(1-adamantyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | C=CCNc1nnc(SCC(=O)NC23CC4CC(CC(C4)C2)C3)s1 |
| InChI | InChI=1S/C17H24N4OS2/c1-2-3-18-15-20-21-16(24-15)23-10-14(22)19-17-7-11-4-12(8-17)6-13(5-11)9-17/h2,11-13H,1,3-10H2,(H,18,20)(H,19,22) |
| InChIKey | AYQODDUMKDFIFR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|