C17H16N4OS2 — CID 42014805
N-naphthalen-1-yl-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 42014805) has the molecular formula C17H16N4OS2 and a molecular weight of 356.48 g/mol. Its IUPAC name is N-naphthalen-1-yl-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-naphthalen-1-yl-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 42014805 |
| Molecular Formula | C17H16N4OS2 |
| Molecular Weight | 356.48 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | N-naphthalen-1-yl-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | C=CCNc1nnc(SCC(=O)Nc2cccc3ccccc23)s1 |
| InChI | InChI=1S/C17H16N4OS2/c1-2-10-18-16-20-21-17(24-16)23-11-15(22)19-14-9-5-7-12-6-3-4-8-13(12)14/h2-9H,1,10-11H2,(H,18,20)(H,19,22) |
| InChIKey | UJFHPBFCJUDBQN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|