C17H22N4OS2 — CID 7798185
N-[(2S)-4-phenylbutan-2-yl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 7798185) has the molecular formula C17H22N4OS2 and a molecular weight of 362.52 g/mol. Its IUPAC name is N-[(2S)-4-phenylbutan-2-yl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(2S)-4-phenylbutan-2-yl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 7798185 |
| Molecular Formula | C17H22N4OS2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-[(2S)-4-phenylbutan-2-yl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | C=CCNc1nnc(SCC(=O)N[C@@H](C)CCc2ccccc2)s1 |
| InChI | InChI=1S/C17H22N4OS2/c1-3-11-18-16-20-21-17(24-16)23-12-15(22)19-13(2)9-10-14-7-5-4-6-8-14/h3-8,13H,1,9-12H2,2H3,(H,18,20)(H,19,22)/t13-/m0/s1 |
| InChIKey | IMFIMUDZIRRGGF-ZDUSSCGKSA-N |
| XLogP | 3.37 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|