C19H25N5OS2 — CID 55523310
N-(1-benzylpyrrolidin-3-yl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide (PubChem CID 55523310) has the molecular formula C19H25N5OS2 and a molecular weight of 403.58 g/mol. Its IUPAC name is N-(1-benzylpyrrolidin-3-yl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | N-(1-benzylpyrrolidin-3-yl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 55523310 |
| Molecular Formula | C19H25N5OS2 |
| Molecular Weight | 403.58 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-(1-benzylpyrrolidin-3-yl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
| SMILES | C=CCNc1nnc(SC(C)C(=O)NC2CCN(Cc3ccccc3)C2)s1 |
| InChI | InChI=1S/C19H25N5OS2/c1-3-10-20-18-22-23-19(27-18)26-14(2)17(25)21-16-9-11-24(13-16)12-15-7-5-4-6-8-15/h3-8,14,16H,1,9-13H2,2H3,(H,20,22)(H,21,25) |
| InChIKey | OTWMEBWEPFNATL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.58 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|