C16H26N4OS2 — CID 11916061
(2R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide (PubChem CID 11916061) has the molecular formula C16H26N4OS2 and a molecular weight of 354.55 g/mol. Its IUPAC name is (2R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | (2R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 11916061 |
| Molecular Formula | C16H26N4OS2 |
| Molecular Weight | 354.55 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (2R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
| SMILES | C=CCNc1nnc(S[C@H](C)C(=O)N[C@H]2CCC[C@@H](C)[C@H]2C)s1 |
| InChI | InChI=1S/C16H26N4OS2/c1-5-9-17-15-19-20-16(23-15)22-12(4)14(21)18-13-8-6-7-10(2)11(13)3/h5,10-13H,1,6-9H2,2-4H3,(H,17,19)(H,18,21)/t10-,11-,12-,13+/m1/s1 |
| InChIKey | ODSQBZQWYHIQKF-LPWJVIDDSA-N |
| XLogP | 3.56 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|