C13H22N4OS2 — CID 11930537
(2R)-2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]propanamide (PubChem CID 11930537) has the molecular formula C13H22N4OS2 and a molecular weight of 314.48 g/mol. Its IUPAC name is (2R)-2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]propanamide.
| Compound Name | (2R)-2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 11930537 |
| Molecular Formula | C13H22N4OS2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (2R)-2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]propanamide |
| SMILES | C[C@@H]1[C@@H](C)CCC[C@H]1NC(=O)[C@@H](C)Sc1nnc(N)s1 |
| InChI | InChI=1S/C13H22N4OS2/c1-7-5-4-6-10(8(7)2)15-11(18)9(3)19-13-17-16-12(14)20-13/h7-10H,4-6H2,1-3H3,(H2,14,16)(H,15,18)/t7-,8+,9+,10+/m0/s1 |
| InChIKey | WHHXWAWABRPFOC-SGIHWFKDSA-N |
| XLogP | 2.54 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |