C23H35N3O2S — CID 11945690
(2R)-2-[[5-(1-adamantyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]propanamide (PubChem CID 11945690) has the molecular formula C23H35N3O2S and a molecular weight of 417.62 g/mol. Its IUPAC name is (2R)-2-[[5-(1-adamantyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]propanamide.
| Compound Name | (2R)-2-[[5-(1-adamantyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 11945690 |
| Molecular Formula | C23H35N3O2S |
| Molecular Weight | 417.62 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | (2R)-2-[[5-(1-adamantyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]propanamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=O)[C@@H](C)Sc1nnc(C23CC4CC(CC(C4)C2)C3)o1 |
| InChI | InChI=1S/C23H35N3O2S/c1-13-5-4-6-19(14(13)2)24-20(27)15(3)29-22-26-25-21(28-22)23-10-16-7-17(11-23)9-18(8-16)12-23/h13-19H,4-12H2,1-3H3,(H,24,27)/t13-,14-,15-,16?,17?,18?,19-,23?/m1/s1 |
| InChIKey | YYMBMUMWCAIAQT-WOVLXHIPSA-N |
| XLogP | 4.96 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.62 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |